C26H33N3O8 — CID 158535574
(4S,4aS,5aR,12aR)-9-acetyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane (PubChem CID 158535574) has the molecular formula C26H33N3O8 and a molecular weight of 515.56 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-acetyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane.
| Compound Name | (4S,4aS,5aR,12aR)-9-acetyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane |
|---|---|
| PubChem CID | 158535574 |
| Molecular Formula | C26H33N3O8 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-acetyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane |
| SMILES | C.CC(=O)c1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C25H29N3O8.CH4/c1-9(29)11-8-14(27(2)3)12-6-10-7-13-18(28(4)5)21(32)17(24(26)35)23(34)25(13,36)22(33)15(10)20(31)16(12)19(11)30;/h8,10,13,18,30-31,34,36H,6-7H2,1-5H3,(H2,26,35);1H4/t10-,13-,18-,25-;/m0./s1 |
| InChIKey | DZGHGILBHNAOKP-HXTJTZPDSA-N |
| XLogP | 0.87 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|