C23H27N4O7Y- — CID 59144436
[(6aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]azanide;yttrium (PubChem CID 59144436) has the molecular formula C23H27N4O7Y- and a molecular weight of 560.40 g/mol. Its IUPAC name is [(6aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]azanide;yttrium.
| Compound Name | [(6aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]azanide;yttrium |
|---|---|
| PubChem CID | 59144436 |
| Molecular Formula | C23H27N4O7Y- |
| Molecular Weight | 560.40 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | [(6aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]azanide;yttrium |
| SMILES | CN(C)c1cc([NH-])c(O)c2c1CC1C[C@H]3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O.[Y] |
| InChI | InChI=1S/C23H27N4O7.Y/c1-26(2)12-7-11(24)17(28)14-9(12)5-8-6-10-16(27(3)4)19(30)15(22(25)33)21(32)23(10,34)20(31)13(8)18(14)29;/h7-8,10,16,24,34H,5-6H2,1-4H3,(H2,28,29,31)(H3,25,30,32,33);/q-1;/t8?,10-,16?,23?;/m0./s1 |
| InChIKey | KWHRHCMRRUOZSQ-RDBXLBGUSA-N |
| XLogP | 0.71 |
| TPSA | 188.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|