C24H26N3O8Y- — CID 89048022
(4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(oxomethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;yttrium (PubChem CID 89048022) has the molecular formula C24H26N3O8Y- and a molecular weight of 573.39 g/mol. Its IUPAC name is (4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(oxomethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;yttrium.
| Compound Name | (4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(oxomethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;yttrium |
|---|---|
| PubChem CID | 89048022 |
| Molecular Formula | C24H26N3O8Y- |
| Molecular Weight | 573.39 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | (4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(oxomethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;yttrium |
| SMILES | CN(C)c1cc([C-]=O)c(O)c2c1C[C@H]1C[C@H]3C(N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O.[Y] |
| InChI | InChI=1S/C24H26N3O8.Y/c1-26(2)13-7-10(8-28)18(29)15-11(13)5-9-6-12-17(27(3)4)20(31)16(23(25)34)22(33)24(12,35)21(32)14(9)19(15)30;/h7,9,12,17,29-30,33,35H,5-6H2,1-4H3,(H2,25,34);/q-1;/t9-,12-,17?,24-;/m0./s1 |
| InChIKey | AYWDGEUPFYPOLX-VDGLWBGOSA-N |
| XLogP | -0.51 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.39 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|