C26H30N2O8 — CID 59518723
(1S,4aR,11aR,12aS)-3,8-diacetyl-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 59518723) has the molecular formula C26H30N2O8 and a molecular weight of 498.53 g/mol. Its IUPAC name is (1S,4aR,11aR,12aS)-3,8-diacetyl-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (1S,4aR,11aR,12aS)-3,8-diacetyl-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 59518723 |
| Molecular Formula | C26H30N2O8 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | (1S,4aR,11aR,12aS)-3,8-diacetyl-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(C(C)=O)cc(N(C)C)c4C[C@H]3C[C@H]2[C@H](N(C)C)C1=O |
| InChI | InChI=1S/C26H30N2O8/c1-10(29)13-9-16(27(3)4)14-7-12-8-15-20(28(5)6)23(33)17(11(2)30)24(34)26(15,36)25(35)18(12)22(32)19(14)21(13)31/h9,12,15,20,31-32,34,36H,7-8H2,1-6H3/t12-,15-,20-,26+/m0/s1 |
| InChIKey | KDVYWKOYSAOHBB-JFMRFRICSA-N |
| XLogP | 1.34 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|