C32H41N3O7 — CID 90244569
(1S,4aR,11aR,12aS)-3-acetyl-8-(6-azaspiro[2.5]octan-6-ylmethyl)-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 90244569) has the molecular formula C32H41N3O7 and a molecular weight of 579.69 g/mol. Its IUPAC name is (1S,4aR,11aR,12aS)-3-acetyl-8-(6-azaspiro[2.5]octan-6-ylmethyl)-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (1S,4aR,11aR,12aS)-3-acetyl-8-(6-azaspiro[2.5]octan-6-ylmethyl)-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 90244569 |
| Molecular Formula | C32H41N3O7 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | (1S,4aR,11aR,12aS)-3-acetyl-8-(6-azaspiro[2.5]octan-6-ylmethyl)-1,10-bis(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(CN5CCC6(CC5)CC6)cc(N(C)C)c4C[C@H]3C[C@H]2[C@H](N(C)C)C1=O |
| InChI | InChI=1S/C32H41N3O7/c1-16(36)22-28(39)25(34(4)5)20-13-17-12-19-21(33(2)3)14-18(15-35-10-8-31(6-7-31)9-11-35)26(37)24(19)27(38)23(17)30(41)32(20,42)29(22)40/h14,17,20,25,37-38,40,42H,6-13,15H2,1-5H3/t17-,20-,25-,32+/m0/s1 |
| InChIKey | RLIYLLJFSHTRQW-DKJPXOPMSA-N |
| XLogP | 2.51 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|