C29H39N4O7+ — CID 147173887
[4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(piperidin-1-ylmethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]azanium (PubChem CID 147173887) has the molecular formula C29H39N4O7+ and a molecular weight of 555.65 g/mol. Its IUPAC name is [4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(piperidin-1-ylmethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]azanium.
| Compound Name | [4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(piperidin-1-ylmethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]azanium |
|---|---|
| PubChem CID | 147173887 |
| Molecular Formula | C29H39N4O7+ |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | [4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(piperidin-1-ylmethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]azanium |
| SMILES | CN(C)c1cc(CN2CCCCC2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C([NH3+])=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H38N4O7/c1-31(2)18-12-15(13-33-8-6-5-7-9-33)23(34)20-16(18)10-14-11-17-22(32(3)4)25(36)21(28(30)39)27(38)29(17,40)26(37)19(14)24(20)35/h12,14,17,22,34-35,38,40H,5-11,13H2,1-4H3,(H2,30,39)/p+1 |
| InChIKey | PVGIGMKPEZJHJQ-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 169.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|