C30H41Cl2N5O8 — CID 70206414
(4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-piperidin-1-ylacetyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride (PubChem CID 70206414) has the molecular formula C30H41Cl2N5O8 and a molecular weight of 670.59 g/mol. Its IUPAC name is (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-piperidin-1-ylacetyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride.
| Compound Name | (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-piperidin-1-ylacetyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 70206414 |
| Molecular Formula | C30H41Cl2N5O8 |
| Molecular Weight | 670.59 g/mol |
| Exact Mass | 669.23 |
| IUPAC Name | (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-piperidin-1-ylacetyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride |
| SMILES | CN(C)c1cc(NC(=O)CN2CCCCC2)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O.Cl.Cl |
| InChI | InChI=1S/C30H39N5O8.2ClH/c1-33(2)18-12-17(32-19(36)13-35-8-6-5-7-9-35)24(37)21-15(18)10-14-11-16-23(34(3)4)26(39)22(29(31)42)28(41)30(16,43)27(40)20(14)25(21)38;;/h12,14,16,23,37-38,41,43H,5-11,13H2,1-4H3,(H2,31,42)(H,32,36);2*1H/t14?,16?,23-,30-;;/m0../s1 |
| InChIKey | WCZFNQQFXUWILZ-QVQPIRPESA-N |
| XLogP | 1.30 |
| TPSA | 196.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.59 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|