C30H37F3N4O7 — CID 54699207
(4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[3-(trifluoromethyl)piperidin-1-yl]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54699207) has the molecular formula C30H37F3N4O7 and a molecular weight of 622.64 g/mol. Its IUPAC name is (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[3-(trifluoromethyl)piperidin-1-yl]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[3-(trifluoromethyl)piperidin-1-yl]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54699207 |
| Molecular Formula | C30H37F3N4O7 |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[3-(trifluoromethyl)piperidin-1-yl]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CN2CCCC(C(F)(F)F)C2)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H37F3N4O7/c1-35(2)18-10-14(11-37-7-5-6-15(12-37)30(31,32)33)23(38)20-16(18)8-13-9-17-22(36(3)4)25(40)21(28(34)43)27(42)29(17,44)26(41)19(13)24(20)39/h10,13,15,17,22,38-39,42,44H,5-9,11-12H2,1-4H3,(H2,34,43)/t13?,15?,17?,22-,29-/m0/s1 |
| InChIKey | HGMWKVQVPRXIAX-OGOLGDCKSA-N |
| XLogP | 1.80 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|