C28H36N2O7 — CID 59550538
(1S,4aR,11aR,12aS)-3-acetyl-7-butoxy-1,10-bis(dimethylamino)-4,4a,6-trihydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 59550538) has the molecular formula C28H36N2O7 and a molecular weight of 512.60 g/mol. Its IUPAC name is (1S,4aR,11aR,12aS)-3-acetyl-7-butoxy-1,10-bis(dimethylamino)-4,4a,6-trihydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (1S,4aR,11aR,12aS)-3-acetyl-7-butoxy-1,10-bis(dimethylamino)-4,4a,6-trihydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 59550538 |
| Molecular Formula | C28H36N2O7 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | (1S,4aR,11aR,12aS)-3-acetyl-7-butoxy-1,10-bis(dimethylamino)-4,4a,6-trihydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CCCCOc1ccc(N(C)C)c2c1C(O)=C1C(=O)[C@]3(O)C(O)=C(C(C)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C28H36N2O7/c1-7-8-11-37-19-10-9-18(29(3)4)16-12-15-13-17-23(30(5)6)25(33)20(14(2)31)26(34)28(17,36)27(35)21(15)24(32)22(16)19/h9-10,15,17,23,32,34,36H,7-8,11-13H2,1-6H3/t15-,17-,23-,28+/m0/s1 |
| InChIKey | DKEZXMLABZRLDU-DKTYAJOYSA-N |
| XLogP | 2.61 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|