C48H56N6O18 — CID 174922378
bis((4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide);oxalic acid (PubChem CID 174922378) has the molecular formula C48H56N6O18 and a molecular weight of 1005.00 g/mol. Its IUPAC name is bis((4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide);oxalic acid.
| Compound Name | bis((4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide);oxalic acid |
|---|---|
| PubChem CID | 174922378 |
| Molecular Formula | C48H56N6O18 |
| Molecular Weight | 1005.00 g/mol |
| Exact Mass | 1004.37 |
| IUPAC Name | bis((4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide);oxalic acid |
| SMILES | CN(C)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O.CN(C)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O.O=C(O)C(=O)O |
| InChI | InChI=1S/2C23H27N3O7.C2H2O4/c2*1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28;3-1(4)2(5)6/h2*5-6,9,11,17,27-28,31,33H,7-8H2,1-4H3,(H2,24,32);(H,3,4)(H,5,6)/t2*9-,11-,17-,23-;/m00./s1 |
| InChIKey | DYUCSNPOLWHLFR-TYGIULIFSA-N |
| XLogP | -0.78 |
| TPSA | 403.86 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.00 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|