C35H51N3O10 — CID 166732411
(4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;butane-2,3-dione;1-butoxybutane (PubChem CID 166732411) has the molecular formula C35H51N3O10 and a molecular weight of 673.80 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;butane-2,3-dione;1-butoxybutane.
| Compound Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;butane-2,3-dione;1-butoxybutane |
|---|---|
| PubChem CID | 166732411 |
| Molecular Formula | C35H51N3O10 |
| Molecular Weight | 673.80 g/mol |
| Exact Mass | 673.36 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;butane-2,3-dione;1-butoxybutane |
| SMILES | CC(=O)C(C)=O.CCCCOCCCC.CN(C)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C23H27N3O7.C8H18O.C4H6O2/c1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28;1-3-5-7-9-8-6-4-2;1-3(5)4(2)6/h5-6,9,11,17,27-28,31,33H,7-8H2,1-4H3,(H2,24,32);3-8H2,1-2H3;1-2H3/t9-,11-,17-,23-;;/m0../s1 |
| InChIKey | FFPGHMSNMABSEI-QVVXJPBESA-N |
| XLogP | 2.80 |
| TPSA | 208.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|