C25H32N4O7 — CID 169438699
(4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[methyl-[2-(methylamino)ethyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 169438699) has the molecular formula C25H32N4O7 and a molecular weight of 500.55 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[methyl-[2-(methylamino)ethyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[methyl-[2-(methylamino)ethyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 169438699 |
| Molecular Formula | C25H32N4O7 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[methyl-[2-(methylamino)ethyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CNCCN(C)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H32N4O7/c1-27-7-8-29(4)14-5-6-15(30)17-12(14)9-11-10-13-19(28(2)3)21(32)18(24(26)35)23(34)25(13,36)22(33)16(11)20(17)31/h5-6,11,13,19,27,30-31,34,36H,7-10H2,1-4H3,(H2,26,35)/t11-,13-,19+,25-/m0/s1 |
| InChIKey | OPMGDOWBNGEAGO-OQZXOALSSA-N |
| XLogP | -0.38 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|