C24H34N6O10 — CID 175236701
(4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;N-(hydroxyamino)-N-(methoxyamino)hydroxylamine (PubChem CID 175236701) has the molecular formula C24H34N6O10 and a molecular weight of 566.57 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;N-(hydroxyamino)-N-(methoxyamino)hydroxylamine.
| Compound Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;N-(hydroxyamino)-N-(methoxyamino)hydroxylamine |
|---|---|
| PubChem CID | 175236701 |
| Molecular Formula | C24H34N6O10 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;N-(hydroxyamino)-N-(methoxyamino)hydroxylamine |
| SMILES | CN(C)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O.CONN(O)NO |
| InChI | InChI=1S/C23H27N3O7.CH7N3O3/c1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28;1-7-3-4(6)2-5/h5-6,9,11,17,27-28,31,33H,7-8H2,1-4H3,(H2,24,32);2-3,5-6H,1H3/t9-,11-,17-,23-;/m0./s1 |
| InChIKey | XRPRCNUMYOHYCA-VQAITOIOSA-N |
| XLogP | -1.33 |
| TPSA | 241.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|