C27H37N3O7 — CID 163815354
(4S,5aR,12aR)-10-butoxy-4,7-bis(dimethylamino)-3,11,12a-trihydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 163815354) has the molecular formula C27H37N3O7 and a molecular weight of 515.61 g/mol. Its IUPAC name is (4S,5aR,12aR)-10-butoxy-4,7-bis(dimethylamino)-3,11,12a-trihydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4S,5aR,12aR)-10-butoxy-4,7-bis(dimethylamino)-3,11,12a-trihydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 163815354 |
| Molecular Formula | C27H37N3O7 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | (4S,5aR,12aR)-10-butoxy-4,7-bis(dimethylamino)-3,11,12a-trihydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CCCCOc1ccc(N(C)C)c2c1C(O)=C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(O)[C@@H](N(C)C)C3C[C@@H]1C2 |
| InChI | InChI=1S/C27H37N3O7/c1-6-7-10-37-17-9-8-16(29(2)3)14-11-13-12-15-21(30(4)5)23(32)20(26(28)35)25(34)27(15,36)24(33)18(13)22(31)19(14)17/h8-9,13,15,20-21,23,31-32,36H,6-7,10-12H2,1-5H3,(H2,28,35)/t13-,15?,20?,21-,23?,27-/m0/s1 |
| InChIKey | JDUIJNZLGJSEJH-OYMYHWOZSA-N |
| XLogP | 0.67 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|