C26H30N4O7 — CID 166899368
(4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,11,12a-trihydroxy-10-(1,3-oxazol-2-yl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 166899368) has the molecular formula C26H30N4O7 and a molecular weight of 510.55 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,11,12a-trihydroxy-10-(1,3-oxazol-2-yl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,11,12a-trihydroxy-10-(1,3-oxazol-2-yl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 166899368 |
| Molecular Formula | C26H30N4O7 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,11,12a-trihydroxy-10-(1,3-oxazol-2-yl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CN(C)c1ccc(-c2ncco2)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C26H30N4O7/c1-29(2)15-6-5-12(25-28-7-8-37-25)17-13(15)9-11-10-14-19(30(3)4)21(32)18(24(27)35)23(34)26(14,36)22(33)16(11)20(17)31/h5-8,11,14,18-19,21,31-32,36H,9-10H2,1-4H3,(H2,27,35)/t11-,14-,18?,19-,21?,26-/m0/s1 |
| InChIKey | JHLVQEMWITXWEX-NMSVZTEVSA-N |
| XLogP | 0.14 |
| TPSA | 170.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|