C28H40N4O7 — CID 126547676
(4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[(2-methylpropylamino)methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 126547676) has the molecular formula C28H40N4O7 and a molecular weight of 544.65 g/mol. Its IUPAC name is (4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[(2-methylpropylamino)methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[(2-methylpropylamino)methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126547676 |
| Molecular Formula | C28H40N4O7 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | (4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[(2-methylpropylamino)methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(C)CNCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(O)C(N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C28H40N4O7/c1-12(2)10-30-11-14-9-17(31(3)4)15-7-13-8-16-21(32(5)6)24(35)20(27(29)38)26(37)28(16,39)25(36)18(13)23(34)19(15)22(14)33/h9,12-13,16,20-21,24,30,33-35,39H,7-8,10-11H2,1-6H3,(H2,29,38)/t13-,16-,20?,21?,24?,28-/m0/s1 |
| InChIKey | CUCIRNRTAPIBBE-NNCPSNLKSA-N |
| XLogP | -0.06 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|