C27H35F3N4O7 — CID 126547828
(4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-9-[(1,1,1-trifluoropropan-2-ylamino)methyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 126547828) has the molecular formula C27H35F3N4O7 and a molecular weight of 584.59 g/mol. Its IUPAC name is (4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-9-[(1,1,1-trifluoropropan-2-ylamino)methyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-9-[(1,1,1-trifluoropropan-2-ylamino)methyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126547828 |
| Molecular Formula | C27H35F3N4O7 |
| Molecular Weight | 584.59 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | (4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-1,12-dioxo-9-[(1,1,1-trifluoropropan-2-ylamino)methyl]-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(NCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(O)C(N(C)C)[C@@H]3C[C@@H]1C2)C(F)(F)F |
| InChI | InChI=1S/C27H35F3N4O7/c1-10(27(28,29)30)32-9-12-8-15(33(2)3)13-6-11-7-14-19(34(4)5)22(37)18(25(31)40)24(39)26(14,41)23(38)16(11)21(36)17(13)20(12)35/h8,10-11,14,18-19,22,32,35-37,41H,6-7,9H2,1-5H3,(H2,31,40)/t10?,11-,14-,18?,19?,22?,26-/m0/s1 |
| InChIKey | BNKPRQSEEZXNNA-OOFXLRDWSA-N |
| XLogP | 0.24 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.59 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|