C23H25IN2O8 — CID 67475882
(3R,4S,4aS,5aR,12aR)-7-acetyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-9-iodo-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 67475882) has the molecular formula C23H25IN2O8 and a molecular weight of 584.36 g/mol. Its IUPAC name is (3R,4S,4aS,5aR,12aR)-7-acetyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-9-iodo-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (3R,4S,4aS,5aR,12aR)-7-acetyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-9-iodo-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67475882 |
| Molecular Formula | C23H25IN2O8 |
| Molecular Weight | 584.36 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | (3R,4S,4aS,5aR,12aR)-7-acetyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-9-iodo-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(=O)c1cc(I)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)[C@H](O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C23H25IN2O8/c1-7(27)9-6-12(24)17(28)14-10(9)4-8-5-11-16(26(2)3)19(30)15(22(25)33)21(32)23(11,34)20(31)13(8)18(14)29/h6,8,11,15-16,19,28-30,34H,4-5H2,1-3H3,(H2,25,33)/t8-,11-,15?,16-,19+,23-/m0/s1 |
| InChIKey | QYNCKXSVYLTQSW-BFUWDSECSA-N |
| XLogP | -0.06 |
| TPSA | 178.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|