C31H37N3O8 — CID 134185051
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-(furan-3-yl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-9-(piperidin-1-ylmethyl)-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134185051) has the molecular formula C31H37N3O8 and a molecular weight of 579.65 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-(furan-3-yl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-9-(piperidin-1-ylmethyl)-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-(furan-3-yl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-9-(piperidin-1-ylmethyl)-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134185051 |
| Molecular Formula | C31H37N3O8 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-(furan-3-yl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-9-(piperidin-1-ylmethyl)-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(CN5CCCCC5)cc(-c5ccoc5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C31H37N3O8/c1-33(2)24-20-12-16-10-19-18(15-6-9-42-14-15)11-17(13-34-7-4-3-5-8-34)25(35)22(19)26(36)21(16)28(38)31(20,41)29(39)23(27(24)37)30(32)40/h6,9,11,14,16,20,23-24,27,35-37,41H,3-5,7-8,10,12-13H2,1-2H3,(H2,32,40)/t16-,20-,23?,24-,27?,31-/m0/s1 |
| InChIKey | KIKFSPHIIVLHDZ-ZHOUTVOXSA-N |
| XLogP | 1.37 |
| TPSA | 177.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|