C28H40N4O8 — CID 126547848
(4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[[(2-methylpropan-2-yl)oxyamino]methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 126547848) has the molecular formula C28H40N4O8 and a molecular weight of 560.65 g/mol. Its IUPAC name is (4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[[(2-methylpropan-2-yl)oxyamino]methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[[(2-methylpropan-2-yl)oxyamino]methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126547848 |
| Molecular Formula | C28H40N4O8 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | (4aS,5aR,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-[[(2-methylpropan-2-yl)oxyamino]methyl]-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CNOC(C)(C)C)c(O)c2c1C[C@H]1C[C@H]3C(N(C)C)C(O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H40N4O8/c1-27(2,3)40-30-11-13-10-16(31(4)5)14-8-12-9-15-20(32(6)7)23(35)19(26(29)38)25(37)28(15,39)24(36)17(12)22(34)18(14)21(13)33/h10,12,15,19-20,23,30,33-35,39H,8-9,11H2,1-7H3,(H2,29,38)/t12-,15-,19?,20?,23?,28-/m0/s1 |
| InChIKey | KFSWZHKXDTWUKE-KOAZFXMNSA-N |
| XLogP | 0.01 |
| TPSA | 185.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|