C34H37N5O8 — CID 10211573
(4S,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-(naphthalen-1-ylcarbamoylamino)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 10211573) has the molecular formula C34H37N5O8 and a molecular weight of 643.70 g/mol. Its IUPAC name is (4S,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-(naphthalen-1-ylcarbamoylamino)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-(naphthalen-1-ylcarbamoylamino)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 10211573 |
| Molecular Formula | C34H37N5O8 |
| Molecular Weight | 643.70 g/mol |
| Exact Mass | 643.26 |
| IUPAC Name | (4S,12aR)-4,7-bis(dimethylamino)-3,10,11,12a-tetrahydroxy-9-(naphthalen-1-ylcarbamoylamino)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)Nc2cccc3ccccc23)c(O)c2c1CC1CC3[C@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C34H37N5O8/c1-38(2)22-14-21(37-33(46)36-20-11-7-9-15-8-5-6-10-17(15)20)27(40)24-18(22)12-16-13-19-26(39(3)4)29(42)25(32(35)45)31(44)34(19,47)30(43)23(16)28(24)41/h5-11,14,16,19,25-26,29,40-42,47H,12-13H2,1-4H3,(H2,35,45)(H2,36,37,46)/t16?,19?,25?,26-,29?,34-/m0/s1 |
| InChIKey | OQMRLDJCGJDHJH-ZBDMRQAUSA-N |
| XLogP | 1.99 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.70 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|