C26H32ClN5O9 — CID 123801570
(4S,4aS,5aR,12aS)-9-[(2-chloroacetyl)carbamoylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 123801570) has the molecular formula C26H32ClN5O9 and a molecular weight of 594.02 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-9-[(2-chloroacetyl)carbamoylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-9-[(2-chloroacetyl)carbamoylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123801570 |
| Molecular Formula | C26H32ClN5O9 |
| Molecular Weight | 594.02 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | (4S,4aS,5aR,12aS)-9-[(2-chloroacetyl)carbamoylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)NC(=O)CCl)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C26H32ClN5O9/c1-31(2)13-7-12(29-25(40)30-14(33)8-27)19(34)16-10(13)5-9-6-11-18(32(3)4)21(36)17(24(28)39)23(38)26(11,41)22(37)15(9)20(16)35/h7,9,11,15,17-18,21,34,36,41H,5-6,8H2,1-4H3,(H2,28,39)(H2,29,30,33,40)/t9-,11-,15?,17?,18-,21?,26-/m0/s1 |
| InChIKey | VXHOXMFARJFRIU-ICKQMQFSSA-N |
| XLogP | -1.39 |
| TPSA | 219.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.02 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|