C28H38N4O9 — CID 91547701
2-methylpropyl N-[(5aS,6aR,7R,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,8,10a-trihydroxy-10,11,12-trioxo-5,5a,6,6a,7,8,9,11a-octahydrotetracen-2-yl]carbamate (PubChem CID 91547701) has the molecular formula C28H38N4O9 and a molecular weight of 574.63 g/mol. Its IUPAC name is 2-methylpropyl N-[(5aS,6aR,7R,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,8,10a-trihydroxy-10,11,12-trioxo-5,5a,6,6a,7,8,9,11a-octahydrotetracen-2-yl]carbamate.
| Compound Name | 2-methylpropyl N-[(5aS,6aR,7R,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,8,10a-trihydroxy-10,11,12-trioxo-5,5a,6,6a,7,8,9,11a-octahydrotetracen-2-yl]carbamate |
|---|---|
| PubChem CID | 91547701 |
| Molecular Formula | C28H38N4O9 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2-methylpropyl N-[(5aS,6aR,7R,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,8,10a-trihydroxy-10,11,12-trioxo-5,5a,6,6a,7,8,9,11a-octahydrotetracen-2-yl]carbamate |
| SMILES | CC(C)COC(=O)Nc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@@]3(O)C(=O)C(C(N)=O)C(O)[C@H](N(C)C)[C@H]3C[C@H]1C2 |
| InChI | InChI=1S/C28H38N4O9/c1-11(2)10-41-27(39)30-15-9-16(31(3)4)13-7-12-8-14-20(32(5)6)23(35)19(26(29)38)25(37)28(14,40)24(36)17(12)22(34)18(13)21(15)33/h9,11-12,14,17,19-20,23,33,35,40H,7-8,10H2,1-6H3,(H2,29,38)(H,30,39)/t12-,14-,17?,19?,20-,23?,28-/m1/s1 |
| InChIKey | JTNBXWILXXRJEJ-UKLAPFTNSA-N |
| XLogP | -0.07 |
| TPSA | 199.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|