C30H43N5O7 — CID 91446485
(4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-9-[[(1-methylpiperidin-4-yl)amino]methyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 91446485) has the molecular formula C30H43N5O7 and a molecular weight of 585.70 g/mol. Its IUPAC name is (4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-9-[[(1-methylpiperidin-4-yl)amino]methyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-9-[[(1-methylpiperidin-4-yl)amino]methyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91446485 |
| Molecular Formula | C30H43N5O7 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | (4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-9-[[(1-methylpiperidin-4-yl)amino]methyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CN1CCC(NCc2cc(N(C)C)c3c(c2O)C(=O)C2C(=O)[C@@]4(O)C(=O)C(C(N)=O)C(O)C(N(C)C)[C@H]4C[C@H]2C3)CC1 |
| InChI | InChI=1S/C30H43N5O7/c1-33(2)19-12-15(13-32-16-6-8-35(5)9-7-16)24(36)21-17(19)10-14-11-18-23(34(3)4)26(38)22(29(31)41)28(40)30(18,42)27(39)20(14)25(21)37/h12,14,16,18,20,22-23,26,32,36,38,42H,6-11,13H2,1-5H3,(H2,31,41)/t14-,18-,20?,22?,23?,26?,30-/m1/s1 |
| InChIKey | XPUMZJYLVFBLLN-QJHUBOKPSA-N |
| XLogP | -1.09 |
| TPSA | 176.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|