C24H31N3O7 — CID 90740022
(4R,4aR,5aS,12aR)-9-(aminomethyl)-4-(dimethylamino)-7-ethyl-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 90740022) has the molecular formula C24H31N3O7 and a molecular weight of 473.53 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-9-(aminomethyl)-4-(dimethylamino)-7-ethyl-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-9-(aminomethyl)-4-(dimethylamino)-7-ethyl-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90740022 |
| Molecular Formula | C24H31N3O7 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (4R,4aR,5aS,12aR)-9-(aminomethyl)-4-(dimethylamino)-7-ethyl-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CCc1cc(CN)c(O)c2c1C[C@@H]1C[C@@H]3[C@@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C24H31N3O7/c1-4-9-5-11(8-25)18(28)15-12(9)6-10-7-13-17(27(2)3)20(30)16(23(26)33)22(32)24(13,34)21(31)14(10)19(15)29/h5,10,13-14,16-17,20,28,30,34H,4,6-8,25H2,1-3H3,(H2,26,33)/t10-,13-,14?,16?,17-,20?,24-/m1/s1 |
| InChIKey | OKJFUWGXISOZHQ-VLHPNSQASA-N |
| XLogP | -1.32 |
| TPSA | 184.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|