C31H34N2O8 — CID 91035224
(4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[4-(2-oxobutyl)phenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 91035224) has the molecular formula C31H34N2O8 and a molecular weight of 562.62 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[4-(2-oxobutyl)phenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[4-(2-oxobutyl)phenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91035224 |
| Molecular Formula | C31H34N2O8 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[4-(2-oxobutyl)phenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CCC(=O)Cc1ccc(-c2ccc(O)c3c2C[C@@H]2C[C@@H]4[C@@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@]4(O)C(=O)C2C3=O)cc1 |
| InChI | InChI=1S/C31H34N2O8/c1-4-17(34)11-14-5-7-15(8-6-14)18-9-10-21(35)23-19(18)12-16-13-20-25(33(2)3)27(37)24(30(32)40)29(39)31(20,41)28(38)22(16)26(23)36/h5-10,16,20,22,24-25,27,35,37,41H,4,11-13H2,1-3H3,(H2,32,40)/t16-,20-,22?,24?,25-,27?,31-/m1/s1 |
| InChIKey | NIPHEMRTGRFPAV-ATADBSINSA-N |
| XLogP | 0.85 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|