C32H37N3O8 — CID 90896800
(4R,4aR,5aS,12aR)-4-(dimethylamino)-7-[4-(2,2-dimethylpropanoylamino)phenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 90896800) has the molecular formula C32H37N3O8 and a molecular weight of 591.66 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-7-[4-(2,2-dimethylpropanoylamino)phenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-7-[4-(2,2-dimethylpropanoylamino)phenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90896800 |
| Molecular Formula | C32H37N3O8 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-7-[4-(2,2-dimethylpropanoylamino)phenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(-c5ccc(NC(=O)C(C)(C)C)cc5)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C32H37N3O8/c1-31(2,3)30(42)34-16-8-6-14(7-9-16)17-10-11-20(36)22-18(17)12-15-13-19-24(35(4)5)26(38)23(29(33)41)28(40)32(19,43)27(39)21(15)25(22)37/h6-11,15,19,21,23-24,26,36,38,43H,12-13H2,1-5H3,(H2,33,41)(H,34,42)/t15-,19-,21?,23?,24-,26?,32-/m1/s1 |
| InChIKey | DHGAFAKLIBLACM-XBKTWORESA-N |
| XLogP | 1.31 |
| TPSA | 187.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|