C31H31N3O8 — CID 90911023
(4R,4aR,5aS,12aR)-7-[2-(4-acetamidophenyl)ethynyl]-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 90911023) has the molecular formula C31H31N3O8 and a molecular weight of 573.60 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-7-[2-(4-acetamidophenyl)ethynyl]-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-7-[2-(4-acetamidophenyl)ethynyl]-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90911023 |
| Molecular Formula | C31H31N3O8 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | (4R,4aR,5aS,12aR)-7-[2-(4-acetamidophenyl)ethynyl]-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C#Cc2ccc(O)c3c2C[C@@H]2C[C@@H]4[C@@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@]4(O)C(=O)C2C3=O)cc1 |
| InChI | InChI=1S/C31H31N3O8/c1-14(35)33-18-9-5-15(6-10-18)4-7-16-8-11-21(36)23-19(16)12-17-13-20-25(34(2)3)27(38)24(30(32)41)29(40)31(20,42)28(39)22(17)26(23)37/h5-6,8-11,17,20,22,24-25,27,36,38,42H,12-13H2,1-3H3,(H2,32,41)(H,33,35)/t17-,20-,22?,24?,25-,27?,31-/m1/s1 |
| InChIKey | AQYKSKIDUPGGDT-MCORBTBSSA-N |
| XLogP | 0.02 |
| TPSA | 187.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|