C29H31N3O9 — CID 91061361
methyl 3-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a,9-trihydroxy-5,6,7-trioxo-5a,8,9,10,10a,11,11a,12-octahydrotetracen-1-yl]-5-aminobenzoate (PubChem CID 91061361) has the molecular formula C29H31N3O9 and a molecular weight of 565.58 g/mol. Its IUPAC name is methyl 3-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a,9-trihydroxy-5,6,7-trioxo-5a,8,9,10,10a,11,11a,12-octahydrotetracen-1-yl]-5-aminobenzoate.
| Compound Name | methyl 3-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a,9-trihydroxy-5,6,7-trioxo-5a,8,9,10,10a,11,11a,12-octahydrotetracen-1-yl]-5-aminobenzoate |
|---|---|
| PubChem CID | 91061361 |
| Molecular Formula | C29H31N3O9 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | methyl 3-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a,9-trihydroxy-5,6,7-trioxo-5a,8,9,10,10a,11,11a,12-octahydrotetracen-1-yl]-5-aminobenzoate |
| SMILES | COC(=O)c1cc(N)cc(-c2ccc(O)c3c2C[C@@H]2C[C@@H]4[C@@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@]4(O)C(=O)C2C3=O)c1 |
| InChI | InChI=1S/C29H31N3O9/c1-32(2)22-17-10-12-9-16-15(11-6-13(28(39)41-3)8-14(30)7-11)4-5-18(33)20(16)23(34)19(12)25(36)29(17,40)26(37)21(24(22)35)27(31)38/h4-8,12,17,19,21-22,24,33,35,40H,9-10,30H2,1-3H3,(H2,31,38)/t12-,17-,19?,21?,22-,24?,29-/m1/s1 |
| InChIKey | GXKIGKCLVRFXEX-TYSIEWGYSA-N |
| XLogP | -0.31 |
| TPSA | 210.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|