C35H44N2O8 — CID 90857461
(4aR,5aS,12aR)-4-(dimethylamino)-7-[5-(4,4-dimethylpentyl)-2-methoxyphenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 90857461) has the molecular formula C35H44N2O8 and a molecular weight of 620.74 g/mol. Its IUPAC name is (4aR,5aS,12aR)-4-(dimethylamino)-7-[5-(4,4-dimethylpentyl)-2-methoxyphenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aR)-4-(dimethylamino)-7-[5-(4,4-dimethylpentyl)-2-methoxyphenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90857461 |
| Molecular Formula | C35H44N2O8 |
| Molecular Weight | 620.74 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | (4aR,5aS,12aR)-4-(dimethylamino)-7-[5-(4,4-dimethylpentyl)-2-methoxyphenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | COc1ccc(CCCC(C)(C)C)cc1-c1ccc(O)c2c1C[C@@H]1C[C@@H]3C(N(C)C)C(O)C(C(N)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C35H44N2O8/c1-34(2,3)13-7-8-17-9-12-24(45-6)20(14-17)19-10-11-23(38)26-21(19)15-18-16-22-28(37(4)5)30(40)27(33(36)43)32(42)35(22,44)31(41)25(18)29(26)39/h9-12,14,18,22,25,27-28,30,38,40,44H,7-8,13,15-16H2,1-6H3,(H2,36,43)/t18-,22-,25?,27?,28?,30?,35-/m1/s1 |
| InChIKey | DPABMMCFYLSIAA-RHNILMMQSA-N |
| XLogP | 2.70 |
| TPSA | 167.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|