C33H39N3O8 — CID 85338203
7-[5-(diethylaminomethyl)-2-methoxyphenyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 85338203) has the molecular formula C33H39N3O8 and a molecular weight of 605.69 g/mol. Its IUPAC name is 7-[5-(diethylaminomethyl)-2-methoxyphenyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 7-[5-(diethylaminomethyl)-2-methoxyphenyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 85338203 |
| Molecular Formula | C33H39N3O8 |
| Molecular Weight | 605.69 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | 7-[5-(diethylaminomethyl)-2-methoxyphenyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCN(CC)Cc1ccc(OC)c(-c2ccc(O)c3c2CC2CC4C(N(C)C)C(=O)C(C(N)=O)C(=O)C4(O)C(=O)C2C3=O)c1 |
| InChI | InChI=1S/C33H39N3O8/c1-6-36(7-2)15-16-8-11-23(44-5)19(12-16)18-9-10-22(37)25-20(18)13-17-14-21-27(35(3)4)29(39)26(32(34)42)31(41)33(21,43)30(40)24(17)28(25)38/h8-12,17,21,24,26-27,37,43H,6-7,13-15H2,1-5H3,(H2,34,42) |
| InChIKey | HVXPDGPXSVOCNB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.69 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|