C31H34FN3O8 — CID 91104737
(4aS,5aR,12aS)-4-(dimethylamino)-7-[5-[(2-fluoroethylamino)methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91104737) has the molecular formula C31H34FN3O8 and a molecular weight of 595.62 g/mol. Its IUPAC name is (4aS,5aR,12aS)-4-(dimethylamino)-7-[5-[(2-fluoroethylamino)methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-4-(dimethylamino)-7-[5-[(2-fluoroethylamino)methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91104737 |
| Molecular Formula | C31H34FN3O8 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | (4aS,5aR,12aS)-4-(dimethylamino)-7-[5-[(2-fluoroethylamino)methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1ccc(CNCCF)cc1-c1ccc(O)c2c1C[C@H]1C[C@H]3C(N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C31H34FN3O8/c1-35(2)25-19-12-15-11-18-16(17-10-14(13-34-9-8-32)4-7-21(17)43-3)5-6-20(36)23(18)26(37)22(15)28(39)31(19,42)29(40)24(27(25)38)30(33)41/h4-7,10,15,19,22,24-25,34,36,42H,8-9,11-13H2,1-3H3,(H2,33,41)/t15-,19-,22?,24?,25?,31-/m0/s1 |
| InChIKey | BFQHCDIIZDNEHM-FWBZUIPKSA-N |
| XLogP | 0.60 |
| TPSA | 176.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|