C32H34F3N3O7 — CID 123396523
4-(dimethylamino)-7-[2-ethyl-5-[(2,2,2-trifluoroethylamino)methyl]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123396523) has the molecular formula C32H34F3N3O7 and a molecular weight of 629.63 g/mol. Its IUPAC name is 4-(dimethylamino)-7-[2-ethyl-5-[(2,2,2-trifluoroethylamino)methyl]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7-[2-ethyl-5-[(2,2,2-trifluoroethylamino)methyl]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123396523 |
| Molecular Formula | C32H34F3N3O7 |
| Molecular Weight | 629.63 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | 4-(dimethylamino)-7-[2-ethyl-5-[(2,2,2-trifluoroethylamino)methyl]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCc1ccc(CNCC(F)(F)F)cc1-c1ccc(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C32H34F3N3O7/c1-4-15-6-5-14(12-37-13-31(33,34)35)9-18(15)17-7-8-21(39)23-19(17)10-16-11-20-25(38(2)3)27(41)24(30(36)44)29(43)32(20,45)28(42)22(16)26(23)40/h5-9,16,20,22,24-25,37,39,45H,4,10-13H2,1-3H3,(H2,36,44) |
| InChIKey | QWOQMLGRKOCJJJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.63 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|