C32H35N3O9 — CID 91485265
ethyl 2-[[4-[(6aS,10R,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]methylamino]acetate (PubChem CID 91485265) has the molecular formula C32H35N3O9 and a molecular weight of 605.64 g/mol. Its IUPAC name is ethyl 2-[[4-[(6aS,10R,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]methylamino]acetate.
| Compound Name | ethyl 2-[[4-[(6aS,10R,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]methylamino]acetate |
|---|---|
| PubChem CID | 91485265 |
| Molecular Formula | C32H35N3O9 |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.24 |
| IUPAC Name | ethyl 2-[[4-[(6aS,10R,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]methylamino]acetate |
| SMILES | CCOC(=O)CNCc1ccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4[C@@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)cc1 |
| InChI | InChI=1S/C32H35N3O9/c1-4-44-22(37)14-34-13-15-5-7-16(8-6-15)18-9-10-21(36)24-19(18)11-17-12-20-26(35(2)3)28(39)25(31(33)42)30(41)32(20,43)29(40)23(17)27(24)38/h5-10,17,20,23,25-26,34,36,43H,4,11-14H2,1-3H3,(H2,33,42)/t17-,20-,23?,25?,26+,32-/m0/s1 |
| InChIKey | ZCUKMVURKOJAAO-IGUQLAJGSA-N |
| XLogP | 0.19 |
| TPSA | 193.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|