C31H31N3O9 — CID 91122456
prop-2-enyl N-[4-[(6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]carbamate (PubChem CID 91122456) has the molecular formula C31H31N3O9 and a molecular weight of 589.60 g/mol. Its IUPAC name is prop-2-enyl N-[4-[(6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]carbamate.
| Compound Name | prop-2-enyl N-[4-[(6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 91122456 |
| Molecular Formula | C31H31N3O9 |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | prop-2-enyl N-[4-[(6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]carbamate |
| SMILES | C=CCOC(=O)Nc1ccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)cc1 |
| InChI | InChI=1S/C31H31N3O9/c1-4-11-43-30(41)33-16-7-5-14(6-8-16)17-9-10-20(35)22-18(17)12-15-13-19-24(34(2)3)26(37)23(29(32)40)28(39)31(19,42)27(38)21(15)25(22)36/h4-10,15,19,21,23-24,35,42H,1,11-13H2,2-3H3,(H2,32,40)(H,33,41)/t15-,19-,21?,23?,24-,31-/m0/s1 |
| InChIKey | PFUSYOOMIJXGHK-STHRNALKSA-N |
| XLogP | 1.27 |
| TPSA | 193.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|