C30H30FN3O9 — CID 91249252
2-fluoroethyl N-[4-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]carbamate (PubChem CID 91249252) has the molecular formula C30H30FN3O9 and a molecular weight of 595.58 g/mol. Its IUPAC name is 2-fluoroethyl N-[4-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]carbamate.
| Compound Name | 2-fluoroethyl N-[4-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 91249252 |
| Molecular Formula | C30H30FN3O9 |
| Molecular Weight | 595.58 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | 2-fluoroethyl N-[4-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]carbamate |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(-c5ccc(NC(=O)OCCF)cc5)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C30H30FN3O9/c1-34(2)23-18-12-14-11-17-16(13-3-5-15(6-4-13)33-29(41)43-10-9-31)7-8-19(35)21(17)24(36)20(14)26(38)30(18,42)27(39)22(25(23)37)28(32)40/h3-8,14,18,20,22-23,35,42H,9-12H2,1-2H3,(H2,32,40)(H,33,41)/t14-,18-,20?,22?,23-,30-/m1/s1 |
| InChIKey | KNXCNDISGGAVFK-RSEITCNNSA-N |
| XLogP | 1.05 |
| TPSA | 193.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.58 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|