C30H31N3O8 — CID 90896335
(4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[4-(propanoylamino)phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90896335) has the molecular formula C30H31N3O8 and a molecular weight of 561.59 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[4-(propanoylamino)phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[4-(propanoylamino)phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90896335 |
| Molecular Formula | C30H31N3O8 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[4-(propanoylamino)phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCC(=O)Nc1ccc(-c2ccc(O)c3c2C[C@@H]2C[C@@H]4[C@@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@]4(O)C(=O)C2C3=O)cc1 |
| InChI | InChI=1S/C30H31N3O8/c1-4-20(35)32-15-7-5-13(6-8-15)16-9-10-19(34)22-17(16)11-14-12-18-24(33(2)3)26(37)23(29(31)40)28(39)30(18,41)27(38)21(14)25(22)36/h5-10,14,18,21,23-24,34,41H,4,11-12H2,1-3H3,(H2,31,40)(H,32,35)/t14-,18-,21?,23?,24-,30-/m1/s1 |
| InChIKey | WELBNWLVRKLHMU-VYSPRQALSA-N |
| XLogP | 0.88 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|