C28H27N3O8 — CID 91049404
(4S,4aS,5aR,12aS)-7-(3-carbamoylphenyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91049404) has the molecular formula C28H27N3O8 and a molecular weight of 533.54 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-(3-carbamoylphenyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-(3-carbamoylphenyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91049404 |
| Molecular Formula | C28H27N3O8 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-(3-carbamoylphenyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(-c5cccc(C(N)=O)c5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C28H27N3O8/c1-31(2)21-16-10-13-9-15-14(11-4-3-5-12(8-11)26(29)37)6-7-17(32)19(15)22(33)18(13)24(35)28(16,39)25(36)20(23(21)34)27(30)38/h3-8,13,16,18,20-21,32,39H,9-10H2,1-2H3,(H2,29,37)(H2,30,38)/t13-,16-,18?,20?,21-,28-/m0/s1 |
| InChIKey | ANKJIFHVXDGVBY-ZHVOLPAKSA-N |
| XLogP | -0.37 |
| TPSA | 198.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|