C29H30N2O8 — CID 123918157
4-(dimethylamino)-10,12a-dihydroxy-7-[3-(methoxymethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123918157) has the molecular formula C29H30N2O8 and a molecular weight of 534.57 g/mol. Its IUPAC name is 4-(dimethylamino)-10,12a-dihydroxy-7-[3-(methoxymethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-10,12a-dihydroxy-7-[3-(methoxymethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123918157 |
| Molecular Formula | C29H30N2O8 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 4-(dimethylamino)-10,12a-dihydroxy-7-[3-(methoxymethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COCc1cccc(-c2ccc(O)c3c2CC2CC4C(N(C)C)C(=O)C(C(N)=O)C(=O)C4(O)C(=O)C2C3=O)c1 |
| InChI | InChI=1S/C29H30N2O8/c1-31(2)23-18-11-15-10-17-16(14-6-4-5-13(9-14)12-39-3)7-8-19(32)21(17)24(33)20(15)26(35)29(18,38)27(36)22(25(23)34)28(30)37/h4-9,15,18,20,22-23,32,38H,10-12H2,1-3H3,(H2,30,37) |
| InChIKey | UKEUVXCVXPYTMG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 164.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|