C32H34N2O8 — CID 91513683
(4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-[3-[2-(methoxymethyl)prop-2-enyl]phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91513683) has the molecular formula C32H34N2O8 and a molecular weight of 574.63 g/mol. Its IUPAC name is (4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-[3-[2-(methoxymethyl)prop-2-enyl]phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-[3-[2-(methoxymethyl)prop-2-enyl]phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91513683 |
| Molecular Formula | C32H34N2O8 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | (4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-[3-[2-(methoxymethyl)prop-2-enyl]phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C=C(COC)Cc1cccc(-c2ccc(O)c3c2C[C@@H]2C[C@@H]4C(N(C)C)C(=O)C(C(N)=O)C(=O)[C@]4(O)C(=O)C2C3=O)c1 |
| InChI | InChI=1S/C32H34N2O8/c1-15(14-42-4)10-16-6-5-7-17(11-16)19-8-9-22(35)24-20(19)12-18-13-21-26(34(2)3)28(37)25(31(33)40)30(39)32(21,41)29(38)23(18)27(24)36/h5-9,11,18,21,23,25-26,35,41H,1,10,12-14H2,2-4H3,(H2,33,40)/t18-,21-,23?,25?,26?,32-/m1/s1 |
| InChIKey | GVFMNRMCRALTDI-JJEWGWNYSA-N |
| XLogP | 1.28 |
| TPSA | 164.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|