C30H27N3O7 — CID 123496570
(4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-[3-[(E)-2-isocyanoethenyl]phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123496570) has the molecular formula C30H27N3O7 and a molecular weight of 541.56 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-[3-[(E)-2-isocyanoethenyl]phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-[3-[(E)-2-isocyanoethenyl]phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123496570 |
| Molecular Formula | C30H27N3O7 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-7-[3-[(E)-2-isocyanoethenyl]phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | [C-]#[N+]/C=C/c1cccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)c1 |
| InChI | InChI=1S/C30H27N3O7/c1-32-10-9-14-5-4-6-15(11-14)17-7-8-20(34)22-18(17)12-16-13-19-24(33(2)3)26(36)23(29(31)39)28(38)30(19,40)27(37)21(16)25(22)35/h4-11,16,19,21,23-24,34,40H,12-13H2,2-3H3,(H2,31,39)/b10-9+/t16-,19-,21?,23?,24-,30-/m0/s1 |
| InChIKey | BMHJLQMJMQGCNK-UUEBRCIQSA-N |
| XLogP | 1.42 |
| TPSA | 159.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|