C29H28N2O7 — CID 91036071
(4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[(E)-2-phenylethenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91036071) has the molecular formula C29H28N2O7 and a molecular weight of 516.55 g/mol. Its IUPAC name is (4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[(E)-2-phenylethenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[(E)-2-phenylethenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91036071 |
| Molecular Formula | C29H28N2O7 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | (4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[(E)-2-phenylethenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(/C=C/c5ccccc5)c4CC3CC12 |
| InChI | InChI=1S/C29H28N2O7/c1-31(2)23-18-13-16-12-17-15(9-8-14-6-4-3-5-7-14)10-11-19(32)21(17)24(33)20(16)26(35)29(18,38)27(36)22(25(23)34)28(30)37/h3-11,16,18,20,22-23,32,38H,12-13H2,1-2H3,(H2,30,37)/b9-8+/t16?,18?,20?,22?,23-,29-/m0/s1 |
| InChIKey | CEGIPIBAWFDYQD-ZXUKNDBLSA-N |
| XLogP | 1.04 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|