C29H23F5N2O7 — CID 91185402
(4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91185402) has the molecular formula C29H23F5N2O7 and a molecular weight of 606.50 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91185402 |
| Molecular Formula | C29H23F5N2O7 |
| Molecular Weight | 606.50 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(C=Cc5c(F)c(F)c(F)c(F)c5F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C29H23F5N2O7/c1-36(2)23-13-8-10-7-12-9(3-5-11-18(30)20(32)22(34)21(33)19(11)31)4-6-14(37)16(12)24(38)15(10)26(40)29(13,43)27(41)17(25(23)39)28(35)42/h3-6,10,13,15,17,23,37,43H,7-8H2,1-2H3,(H2,35,42)/t10-,13-,15?,17?,23-,29-/m0/s1 |
| InChIKey | KMQDHMROJIOOQO-VLQIFHQYSA-N |
| XLogP | 1.73 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|