C23H24N2O9 — CID 123809833
methyl 8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate (PubChem CID 123809833) has the molecular formula C23H24N2O9 and a molecular weight of 472.45 g/mol. Its IUPAC name is methyl 8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate.
| Compound Name | methyl 8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate |
|---|---|
| PubChem CID | 123809833 |
| Molecular Formula | C23H24N2O9 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | methyl 8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate |
| SMILES | COC(=O)c1ccc(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C23H24N2O9/c1-25(2)16-11-7-8-6-10-9(22(32)34-3)4-5-12(26)14(10)17(27)13(8)19(29)23(11,33)20(30)15(18(16)28)21(24)31/h4-5,8,11,13,15-16,26,33H,6-7H2,1-3H3,(H2,24,31) |
| InChIKey | NWDRYPJGRUOVKW-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 181.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|