C24H25NO9 — CID 90820362
methyl (6aS,10S,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-10-propan-2-yl-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate (PubChem CID 90820362) has the molecular formula C24H25NO9 and a molecular weight of 471.46 g/mol. Its IUPAC name is methyl (6aS,10S,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-10-propan-2-yl-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate.
| Compound Name | methyl (6aS,10S,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-10-propan-2-yl-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate |
|---|---|
| PubChem CID | 90820362 |
| Molecular Formula | C24H25NO9 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | methyl (6aS,10S,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-10-propan-2-yl-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate |
| SMILES | COC(=O)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](C(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C24H25NO9/c1-8(2)14-12-7-9-6-11-10(23(32)34-3)4-5-13(26)16(11)19(28)15(9)20(29)24(12,33)21(30)17(18(14)27)22(25)31/h4-5,8-9,12,14-15,17,26,33H,6-7H2,1-3H3,(H2,25,31)/t9-,12-,14-,15?,17?,24-/m0/s1 |
| InChIKey | DTSDQEUIOWSTKR-WIUOQMRESA-N |
| XLogP | -0.00 |
| TPSA | 178.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|