C31H33NO10 — CID 91505574
(4S,4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-7-(3,4,5-trimethoxyphenyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91505574) has the molecular formula C31H33NO10 and a molecular weight of 579.60 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-7-(3,4,5-trimethoxyphenyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-7-(3,4,5-trimethoxyphenyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91505574 |
| Molecular Formula | C31H33NO10 |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | (4S,4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-7-(3,4,5-trimethoxyphenyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1cc(-c2ccc(O)c3c2C[C@H]2C[C@H]4[C@H](C(C)C)C(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C31H33NO10/c1-12(2)21-17-9-14-8-16-15(13-10-19(40-3)27(42-5)20(11-13)41-4)6-7-18(33)23(16)26(35)22(14)28(36)31(17,39)29(37)24(25(21)34)30(32)38/h6-7,10-12,14,17,21-22,24,33,39H,8-9H2,1-5H3,(H2,32,38)/t14-,17-,21-,22?,24?,31-/m0/s1 |
| InChIKey | MGZCYIGPRILMSP-GKPBMBMPSA-N |
| XLogP | 1.90 |
| TPSA | 179.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|