C37H43NO7 — CID 91187309
(4S,4aS,5aR,12aS)-7-[5-(cyclohexylmethyl)-2-ethylphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91187309) has the molecular formula C37H43NO7 and a molecular weight of 613.75 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-[5-(cyclohexylmethyl)-2-ethylphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-[5-(cyclohexylmethyl)-2-ethylphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91187309 |
| Molecular Formula | C37H43NO7 |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-[5-(cyclohexylmethyl)-2-ethylphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCc1ccc(CC2CCCCC2)cc1-c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](C(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C37H43NO7/c1-4-21-11-10-20(14-19-8-6-5-7-9-19)15-24(21)23-12-13-27(39)30-25(23)16-22-17-26-28(18(2)3)32(40)31(36(38)44)35(43)37(26,45)34(42)29(22)33(30)41/h10-13,15,18-19,22,26,28-29,31,39,45H,4-9,14,16-17H2,1-3H3,(H2,38,44)/t22-,26-,28-,29?,31?,37-/m0/s1 |
| InChIKey | LCPMMUYGBMAOMY-SPFBNVCFSA-N |
| XLogP | 4.56 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|