C37H44N2O7 — CID 91409270
(4aR,5aS,12aR)-7-[4-(3-cyclohexyl-2-methylpropyl)phenyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91409270) has the molecular formula C37H44N2O7 and a molecular weight of 628.77 g/mol. Its IUPAC name is (4aR,5aS,12aR)-7-[4-(3-cyclohexyl-2-methylpropyl)phenyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aR)-7-[4-(3-cyclohexyl-2-methylpropyl)phenyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91409270 |
| Molecular Formula | C37H44N2O7 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | (4aR,5aS,12aR)-7-[4-(3-cyclohexyl-2-methylpropyl)phenyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(Cc1ccc(-c2ccc(O)c3c2C[C@@H]2C[C@@H]4C(N(C)C)C(=O)C(C(N)=O)C(=O)[C@]4(O)C(=O)C2C3=O)cc1)CC1CCCCC1 |
| InChI | InChI=1S/C37H44N2O7/c1-19(15-20-7-5-4-6-8-20)16-21-9-11-22(12-10-21)24-13-14-27(40)29-25(24)17-23-18-26-31(39(2)3)33(42)30(36(38)45)35(44)37(26,46)34(43)28(23)32(29)41/h9-14,19-20,23,26,28,30-31,40,46H,4-8,15-18H2,1-3H3,(H2,38,45)/t19?,23-,26-,28?,30?,31?,37-/m1/s1 |
| InChIKey | KYHFGWMYKLAQOM-GQWJRIPYSA-N |
| XLogP | 3.68 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|