C34H40N2O7 — CID 91000392
(4aR,5aS,12aR)-7-[4-(2-cyclohexylethyl)cyclopenta-1,3-dien-1-yl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91000392) has the molecular formula C34H40N2O7 and a molecular weight of 588.70 g/mol. Its IUPAC name is (4aR,5aS,12aR)-7-[4-(2-cyclohexylethyl)cyclopenta-1,3-dien-1-yl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aR)-7-[4-(2-cyclohexylethyl)cyclopenta-1,3-dien-1-yl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91000392 |
| Molecular Formula | C34H40N2O7 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | (4aR,5aS,12aR)-7-[4-(2-cyclohexylethyl)cyclopenta-1,3-dien-1-yl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(C5=CC=C(CCC6CCCCC6)C5)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C34H40N2O7/c1-36(2)28-23-16-20-15-22-21(19-11-10-18(14-19)9-8-17-6-4-3-5-7-17)12-13-24(37)26(22)29(38)25(20)31(40)34(23,43)32(41)27(30(28)39)33(35)42/h10-13,17,20,23,25,27-28,37,43H,3-9,14-16H2,1-2H3,(H2,35,42)/t20-,23-,25?,27?,28?,34-/m1/s1 |
| InChIKey | WYNRYEHKCIVASB-YYVGTTIASA-N |
| XLogP | 2.94 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|