C27H28N2O7 — CID 91365390
(4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-(4-methylcyclopenta-1,3-dien-1-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91365390) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-(4-methylcyclopenta-1,3-dien-1-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-(4-methylcyclopenta-1,3-dien-1-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91365390 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-(4-methylcyclopenta-1,3-dien-1-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC1=CC=C(c2ccc(O)c3c2C[C@@H]2C[C@@H]4[C@@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@]4(O)C(=O)C2C3=O)C1 |
| InChI | InChI=1S/C27H28N2O7/c1-11-4-5-12(8-11)14-6-7-17(30)19-15(14)9-13-10-16-21(29(2)3)23(32)20(26(28)35)25(34)27(16,36)24(33)18(13)22(19)31/h4-7,13,16,18,20-21,30,36H,8-10H2,1-3H3,(H2,28,35)/t13-,16-,18?,20?,21-,27-/m1/s1 |
| InChIKey | SEOBUNKMSACHEZ-OXLKLXRYSA-N |
| XLogP | 0.60 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|